C14H28N2S — CID 170361702
(7E)-2-(2-aminopropyl)-N,9-dimethyl-3,4,5,6,9,10-hexahydro-2H-thiecin-5-amine (PubChem CID 170361702) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is (7E)-2-(2-aminopropyl)-N,9-dimethyl-3,4,5,6,9,10-hexahydro-2H-thiecin-5-amine.
| Compound Name | (7E)-2-(2-aminopropyl)-N,9-dimethyl-3,4,5,6,9,10-hexahydro-2H-thiecin-5-amine |
|---|---|
| PubChem CID | 170361702 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (7E)-2-(2-aminopropyl)-N,9-dimethyl-3,4,5,6,9,10-hexahydro-2H-thiecin-5-amine |
| SMILES | CNC1C/C=C/C(C)CSC(CC(C)N)CC1 |
| InChI | InChI=1S/C14H28N2S/c1-11-5-4-6-13(16-3)7-8-14(17-10-11)9-12(2)15/h4-5,11-14,16H,6-10,15H2,1-3H3/b5-4+ |
| InChIKey | UISKHRQMTAFXDL-SNAWJCMRSA-N |
| XLogP | 2.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|