About (2R)-3-methyl-1,3-thiazolidin-2-ol
(2R)-3-methyl-1,3-thiazolidin-2-ol (PubChem CID 170365167) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is (2R)-3-methyl-1,3-thiazolidin-2-ol.
Molecular Properties
| Compound Name | (2R)-3-methyl-1,3-thiazolidin-2-ol |
| PubChem CID | 170365167 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | (2R)-3-methyl-1,3-thiazolidin-2-ol |
| SMILES | CN1CCS[C@H]1O |
| InChI | InChI=1S/C4H9NOS/c1-5-2-3-7-4(5)6/h4,6H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | PWRWGTUXFJTOLI-SCSAIBSYSA-N |
| XLogP | -0.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3-methyl-1,3-thiazolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-methyl-1,3-thiazolidin-2-ol?
The IUPAC name of (2R)-3-methyl-1,3-thiazolidin-2-ol (CID 170365167) is (2R)-3-methyl-1,3-thiazolidin-2-ol.
What is the SMILES notation for (2R)-3-methyl-1,3-thiazolidin-2-ol?
The canonical SMILES for (2R)-3-methyl-1,3-thiazolidin-2-ol is CN1CCS[C@H]1O.
What is the InChIKey of (2R)-3-methyl-1,3-thiazolidin-2-ol?
The InChIKey is PWRWGTUXFJTOLI-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H9NOS/c1-5-2-3-7-4(5)6/h4,6H,2-3H2,1H3/t4-/m1/s1.
What are the key properties of (2R)-3-methyl-1,3-thiazolidin-2-ol?
(2R)-3-methyl-1,3-thiazolidin-2-ol has a molecular weight of 119.19 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-1,3-thiazolidin-2-ol is sourced from PubChem (CID 170365167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).