C17H14F3N5O3S — CID 170365323
methyl 6-[(Z)-N'-hydroxycarbamimidoyl]-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxylate (PubChem CID 170365323) has the molecular formula C17H14F3N5O3S and a molecular weight of 425.39 g/mol. Its IUPAC name is methyl 6-[(Z)-N'-hydroxycarbamimidoyl]-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(Z)-N'-hydroxycarbamimidoyl]-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170365323 |
| Molecular Formula | C17H14F3N5O3S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | methyl 6-[(Z)-N'-hydroxycarbamimidoyl]-2-[1-methyl-5-(trifluoromethylsulfanyl)benzimidazol-2-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(/C(N)=N/O)nc1-c1nc2cc(SC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C17H14F3N5O3S/c1-25-12-6-3-8(29-17(18,19)20)7-11(12)23-15(25)13-9(16(26)28-2)4-5-10(22-13)14(21)24-27/h3-7,27H,1-2H3,(H2,21,24) |
| InChIKey | HAAAQASGJFRZOE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|