C19H18IN5O — CID 170365334
3-[6-ethyl-5-(1-iodopyrrolidin-3-yl)oxypyrazin-2-yl]-1H-indole-7-carbonitrile (PubChem CID 170365334) has the molecular formula C19H18IN5O and a molecular weight of 459.29 g/mol. Its IUPAC name is 3-[6-ethyl-5-(1-iodopyrrolidin-3-yl)oxypyrazin-2-yl]-1H-indole-7-carbonitrile.
| Compound Name | 3-[6-ethyl-5-(1-iodopyrrolidin-3-yl)oxypyrazin-2-yl]-1H-indole-7-carbonitrile |
|---|---|
| PubChem CID | 170365334 |
| Molecular Formula | C19H18IN5O |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 3-[6-ethyl-5-(1-iodopyrrolidin-3-yl)oxypyrazin-2-yl]-1H-indole-7-carbonitrile |
| SMILES | CCc1nc(-c2c[nH]c3c(C#N)cccc23)cnc1OC1CCN(I)C1 |
| InChI | InChI=1S/C19H18IN5O/c1-2-16-19(26-13-6-7-25(20)11-13)23-10-17(24-16)15-9-22-18-12(8-21)4-3-5-14(15)18/h3-5,9-10,13,22H,2,6-7,11H2,1H3 |
| InChIKey | YICPOUBLPUXLGA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|