About 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol
3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol (PubChem CID 170365368) has the molecular formula C22H28O4
and a molecular weight of 356.46 g/mol. Its IUPAC name is 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol.
Molecular Properties
| Compound Name | 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol |
| PubChem CID | 170365368 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol |
| SMILES | CCOCCCCOc1cc(O)c2c(c1)OC(C)(C)c1ccc(C)cc1-2 |
| InChI | InChI=1S/C22H28O4/c1-5-24-10-6-7-11-25-16-13-19(23)21-17-12-15(2)8-9-18(17)22(3,4)26-20(21)14-16/h8-9,12-14,23H,5-7,10-11H2,1-4H3 |
| InChIKey | YLDAPBPITNAYFI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol?
The IUPAC name of 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol (CID 170365368) is 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol.
What is the SMILES notation for 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol?
The canonical SMILES for 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol is CCOCCCCOc1cc(O)c2c(c1)OC(C)(C)c1ccc(C)cc1-2.
What is the InChIKey of 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol?
The InChIKey is YLDAPBPITNAYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O4/c1-5-24-10-6-7-11-25-16-13-19(23)21-17-12-15(2)8-9-18(17)22(3,4)26-20(21)14-16/h8-9,12-14,23H,5-7,10-11H2,1-4H3.
What are the key properties of 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol?
3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol has a molecular weight of 356.46 g/mol, XLogP of 5.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethoxybutoxy)-6,6,9-trimethylbenzo[c]chromen-1-ol is sourced from PubChem (CID 170365368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).