About ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate
ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate (PubChem CID 170366692) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate.
Molecular Properties
| Compound Name | ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate |
| PubChem CID | 170366692 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate |
| SMILES | CCOC(=O)C1CN(C)C2(CCc3ccccc32)CC1=O |
| InChI | InChI=1S/C17H21NO3/c1-3-21-16(20)13-11-18(2)17(10-15(13)19)9-8-12-6-4-5-7-14(12)17/h4-7,13H,3,8-11H2,1-2H3 |
| InChIKey | KKVXPEPYADFCDA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate?
The IUPAC name of ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate (CID 170366692) is ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate.
What is the SMILES notation for ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate?
The canonical SMILES for ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate is CCOC(=O)C1CN(C)C2(CCc3ccccc32)CC1=O.
What is the InChIKey of ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate?
The InChIKey is KKVXPEPYADFCDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3/c1-3-21-16(20)13-11-18(2)17(10-15(13)19)9-8-12-6-4-5-7-14(12)17/h4-7,13H,3,8-11H2,1-2H3.
What are the key properties of ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate?
ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate has a molecular weight of 287.36 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1'-methyl-4'-oxospiro[1,2-dihydroindene-3,6'-piperidine]-3'-carboxylate is sourced from PubChem (CID 170366692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).