C23H26O5 — CID 170366803
2,4-dihydroxy-6-(4-hydroxyphenyl)-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid (PubChem CID 170366803) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2,4-dihydroxy-6-(4-hydroxyphenyl)-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid.
| Compound Name | 2,4-dihydroxy-6-(4-hydroxyphenyl)-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 170366803 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2,4-dihydroxy-6-(4-hydroxyphenyl)-3-[(2,4,4-trimethylcyclohexen-1-yl)methyl]benzoic acid |
| SMILES | CC1=C(Cc2c(O)cc(-c3ccc(O)cc3)c(C(=O)O)c2O)CCC(C)(C)C1 |
| InChI | InChI=1S/C23H26O5/c1-13-12-23(2,3)9-8-15(13)10-18-19(25)11-17(20(21(18)26)22(27)28)14-4-6-16(24)7-5-14/h4-7,11,24-26H,8-10,12H2,1-3H3,(H,27,28) |
| InChIKey | ZGZJOMDQORNXCQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|