C15H20F3N3O — CID 170367926
(3S,8S)-8-ethyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170367926) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is (3S,8S)-8-ethyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3S,8S)-8-ethyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170367926 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (3S,8S)-8-ethyl-3-[[2-(trifluoromethyl)pyrimidin-4-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC[C@@]12CCCN1[C@H](COc1ccnc(C(F)(F)F)n1)CC2 |
| InChI | InChI=1S/C15H20F3N3O/c1-2-14-6-3-9-21(14)11(4-7-14)10-22-12-5-8-19-13(20-12)15(16,17)18/h5,8,11H,2-4,6-7,9-10H2,1H3/t11-,14-/m0/s1 |
| InChIKey | JWYDZFMIZNOMSD-FZMZJTMJSA-N |
| XLogP | 3.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |