C10H19NO3 — CID 170367992
3-[[(3R,4R)-1,4-dimethylpyrrolidin-3-yl]methoxy]propanoic acid (PubChem CID 170367992) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-[[(3R,4R)-1,4-dimethylpyrrolidin-3-yl]methoxy]propanoic acid.
| Compound Name | 3-[[(3R,4R)-1,4-dimethylpyrrolidin-3-yl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 170367992 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 3-[[(3R,4R)-1,4-dimethylpyrrolidin-3-yl]methoxy]propanoic acid |
| SMILES | C[C@H]1CN(C)C[C@@H]1COCCC(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-8-5-11(2)6-9(8)7-14-4-3-10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)/t8-,9+/m0/s1 |
| InChIKey | OKZYYLFIZTUQIY-DTWKUNHWSA-N |
| XLogP | 0.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|