C16H23F2N3OS — CID 170368012
(3S,8S)-3-[[5-(difluoromethyl)-2-methylsulfanylpyrimidin-4-yl]oxymethyl]-8-ethyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170368012) has the molecular formula C16H23F2N3OS and a molecular weight of 343.44 g/mol. Its IUPAC name is (3S,8S)-3-[[5-(difluoromethyl)-2-methylsulfanylpyrimidin-4-yl]oxymethyl]-8-ethyl-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3S,8S)-3-[[5-(difluoromethyl)-2-methylsulfanylpyrimidin-4-yl]oxymethyl]-8-ethyl-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170368012 |
| Molecular Formula | C16H23F2N3OS |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (3S,8S)-3-[[5-(difluoromethyl)-2-methylsulfanylpyrimidin-4-yl]oxymethyl]-8-ethyl-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC[C@@]12CCCN1[C@H](COc1nc(SC)ncc1C(F)F)CC2 |
| InChI | InChI=1S/C16H23F2N3OS/c1-3-16-6-4-8-21(16)11(5-7-16)10-22-14-12(13(17)18)9-19-15(20-14)23-2/h9,11,13H,3-8,10H2,1-2H3/t11-,16-/m0/s1 |
| InChIKey | YLPHKOPTPLXXAD-ZBEGNZNMSA-N |
| XLogP | 3.92 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |