C15H23F9O2 — CID 170368287
1-[4,4,7,8,8,8-hexafluoro-3,5,5-trimethyl-7-(trifluoromethyl)octan-3-yl]oxypropan-2-ol (PubChem CID 170368287) has the molecular formula C15H23F9O2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 1-[4,4,7,8,8,8-hexafluoro-3,5,5-trimethyl-7-(trifluoromethyl)octan-3-yl]oxypropan-2-ol.
| Compound Name | 1-[4,4,7,8,8,8-hexafluoro-3,5,5-trimethyl-7-(trifluoromethyl)octan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 170368287 |
| Molecular Formula | C15H23F9O2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[4,4,7,8,8,8-hexafluoro-3,5,5-trimethyl-7-(trifluoromethyl)octan-3-yl]oxypropan-2-ol |
| SMILES | CCC(C)(OCC(C)O)C(F)(F)C(C)(C)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H23F9O2/c1-6-11(5,26-7-9(2)25)13(17,18)10(3,4)8-12(16,14(19,20)21)15(22,23)24/h9,25H,6-8H2,1-5H3 |
| InChIKey | KFIGGTFYPDZNHM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |