C18H17FN5O3P — CID 170368347
2-[4-(3-fluoro-5-phosphanylphenyl)-3-methoxy-6-oxopyridazin-1-yl]-N-(5-methylpyrimidin-2-yl)acetamide (PubChem CID 170368347) has the molecular formula C18H17FN5O3P and a molecular weight of 401.34 g/mol. Its IUPAC name is 2-[4-(3-fluoro-5-phosphanylphenyl)-3-methoxy-6-oxopyridazin-1-yl]-N-(5-methylpyrimidin-2-yl)acetamide.
| Compound Name | 2-[4-(3-fluoro-5-phosphanylphenyl)-3-methoxy-6-oxopyridazin-1-yl]-N-(5-methylpyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 170368347 |
| Molecular Formula | C18H17FN5O3P |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[4-(3-fluoro-5-phosphanylphenyl)-3-methoxy-6-oxopyridazin-1-yl]-N-(5-methylpyrimidin-2-yl)acetamide |
| SMILES | COc1nn(CC(=O)Nc2ncc(C)cn2)c(=O)cc1-c1cc(F)cc(P)c1 |
| InChI | InChI=1S/C18H17FN5O3P/c1-10-7-20-18(21-8-10)22-15(25)9-24-16(26)6-14(17(23-24)27-2)11-3-12(19)5-13(28)4-11/h3-8H,9,28H2,1-2H3,(H,20,21,22,25) |
| InChIKey | GJJQJIILONUKMZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|