C14H23F3N2O3 — CID 170368582
[(3S,8S)-8-(ethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate (PubChem CID 170368582) has the molecular formula C14H23F3N2O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is [(3S,8S)-8-(ethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate.
| Compound Name | [(3S,8S)-8-(ethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 170368582 |
| Molecular Formula | C14H23F3N2O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(3S,8S)-8-(ethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate |
| SMILES | CCOC[C@@]12CCCN1[C@H](COC(=O)N(C)C(F)(F)F)CC2 |
| InChI | InChI=1S/C14H23F3N2O3/c1-3-21-10-13-6-4-8-19(13)11(5-7-13)9-22-12(20)18(2)14(15,16)17/h11H,3-10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | RTODRBUIXNDVMU-AAEUAGOBSA-N |
| XLogP | 2.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|