C20H15ClF3N3O2 — CID 170368730
6-[(1S)-2-amino-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide (PubChem CID 170368730) has the molecular formula C20H15ClF3N3O2 and a molecular weight of 421.81 g/mol. Its IUPAC name is 6-[(1S)-2-amino-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | 6-[(1S)-2-amino-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 170368730 |
| Molecular Formula | C20H15ClF3N3O2 |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 6-[(1S)-2-amino-1-hydroxy-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide |
| SMILES | NC[C@@](O)(c1ccccc1)c1cc(C(N)=O)c(F)c(-c2cc(Cl)c(F)cc2F)n1 |
| InChI | InChI=1S/C20H15ClF3N3O2/c21-13-6-11(14(22)8-15(13)23)18-17(24)12(19(26)28)7-16(27-18)20(29,9-25)10-4-2-1-3-5-10/h1-8,29H,9,25H2,(H2,26,28)/t20-/m1/s1 |
| InChIKey | UWJNLKFXEYKLHZ-HXUWFJFHSA-N |
| XLogP | 3.11 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|