About 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane
1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane (PubChem CID 170368810) has the molecular formula C16H33NOS
and a molecular weight of 287.51 g/mol. Its IUPAC name is 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane.
Molecular Properties
| Compound Name | 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane |
| PubChem CID | 170368810 |
| Molecular Formula | C16H33NOS |
| Molecular Weight | 287.51 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane |
| SMILES | CC(C)(C)OCC1(CN2CCCS(C)(C)CC2)CC1 |
| InChI | InChI=1S/C16H33NOS/c1-15(2,3)18-14-16(7-8-16)13-17-9-6-11-19(4,5)12-10-17/h6-14H2,1-5H3 |
| InChIKey | HBOPNUINCFFCQR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane?
The IUPAC name of 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane (CID 170368810) is 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane.
What is the SMILES notation for 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane?
The canonical SMILES for 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane is CC(C)(C)OCC1(CN2CCCS(C)(C)CC2)CC1.
What is the InChIKey of 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane?
The InChIKey is HBOPNUINCFFCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NOS/c1-15(2,3)18-14-16(7-8-16)13-17-9-6-11-19(4,5)12-10-17/h6-14H2,1-5H3.
What are the key properties of 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane?
1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane has a molecular weight of 287.51 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-4-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-1,4-thiazepane is sourced from PubChem (CID 170368810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).