C30H26N2O+2 — CID 170368885
7-methoxy-19-methyl-13-[(1-methylpyridin-1-ium-4-yl)methyl]-13-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,10,13,15,17(22),18,20-undecaene (PubChem CID 170368885) has the molecular formula C30H26N2O+2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 7-methoxy-19-methyl-13-[(1-methylpyridin-1-ium-4-yl)methyl]-13-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,10,13,15,17(22),18,20-undecaene.
| Compound Name | 7-methoxy-19-methyl-13-[(1-methylpyridin-1-ium-4-yl)methyl]-13-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,10,13,15,17(22),18,20-undecaene |
|---|---|
| PubChem CID | 170368885 |
| Molecular Formula | C30H26N2O+2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 7-methoxy-19-methyl-13-[(1-methylpyridin-1-ium-4-yl)methyl]-13-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,10,13,15,17(22),18,20-undecaene |
| SMILES | COc1ccc2c(ccc3c2cc2c4ccc(C)cc4ccc2[n+]3Cc2cc[n+](C)cc2)c1 |
| InChI | InChI=1S/C30H26N2O/c1-20-4-8-25-22(16-20)5-10-29-27(25)18-28-26-9-7-24(33-3)17-23(26)6-11-30(28)32(29)19-21-12-14-31(2)15-13-21/h4-18H,19H2,1-3H3/q+2 |
| InChIKey | VZSQXWVFCHOYFZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|