C15H16F2N3O2P — CID 170369188
2-[4-(2,3-difluoro-5-phosphanylphenyl)-6-oxo-3-propan-2-ylpyridazin-1-yl]acetamide (PubChem CID 170369188) has the molecular formula C15H16F2N3O2P and a molecular weight of 339.28 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-5-phosphanylphenyl)-6-oxo-3-propan-2-ylpyridazin-1-yl]acetamide.
| Compound Name | 2-[4-(2,3-difluoro-5-phosphanylphenyl)-6-oxo-3-propan-2-ylpyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 170369188 |
| Molecular Formula | C15H16F2N3O2P |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[4-(2,3-difluoro-5-phosphanylphenyl)-6-oxo-3-propan-2-ylpyridazin-1-yl]acetamide |
| SMILES | CC(C)c1nn(CC(N)=O)c(=O)cc1-c1cc(P)cc(F)c1F |
| InChI | InChI=1S/C15H16F2N3O2P/c1-7(2)15-10(5-13(22)20(19-15)6-12(18)21)9-3-8(23)4-11(16)14(9)17/h3-5,7H,6,23H2,1-2H3,(H2,18,21) |
| InChIKey | OMSLAZYQHSKWMS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|