C19H18N2O2 — CID 17036922
5-(3-hydroxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile (PubChem CID 17036922) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile.
| Compound Name | 5-(3-hydroxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile |
|---|---|
| PubChem CID | 17036922 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-(3-hydroxyphenyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-9-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C1OCCCC1C(c1cccc(O)c1)N2 |
| InChI | InChI=1S/C19H18N2O2/c20-11-12-6-7-17-16(9-12)19-15(5-2-8-23-19)18(21-17)13-3-1-4-14(22)10-13/h1,3-4,6-7,9-10,15,18-19,21-22H,2,5,8H2 |
| InChIKey | WMVGWPFTFAKDPZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |