C17H16IN5O2 — CID 170369273
2-[4-(1-iodoethyl)-7-methyl-1-oxophthalazin-2-yl]-N-pyrimidin-2-ylacetamide (PubChem CID 170369273) has the molecular formula C17H16IN5O2 and a molecular weight of 449.25 g/mol. Its IUPAC name is 2-[4-(1-iodoethyl)-7-methyl-1-oxophthalazin-2-yl]-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-[4-(1-iodoethyl)-7-methyl-1-oxophthalazin-2-yl]-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 170369273 |
| Molecular Formula | C17H16IN5O2 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 2-[4-(1-iodoethyl)-7-methyl-1-oxophthalazin-2-yl]-N-pyrimidin-2-ylacetamide |
| SMILES | Cc1ccc2c(C(C)I)nn(CC(=O)Nc3ncccn3)c(=O)c2c1 |
| InChI | InChI=1S/C17H16IN5O2/c1-10-4-5-12-13(8-10)16(25)23(22-15(12)11(2)18)9-14(24)21-17-19-6-3-7-20-17/h3-8,11H,9H2,1-2H3,(H,19,20,21,24) |
| InChIKey | GLTOPTRSSWTYAB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|