C15H11BrF2N5O2P — CID 170369679
2-[6-bromo-5-fluoro-1-oxo-4-(phosphanylmethyl)phthalazin-2-yl]-N-(5-fluoropyrimidin-2-yl)acetamide (PubChem CID 170369679) has the molecular formula C15H11BrF2N5O2P and a molecular weight of 442.16 g/mol. Its IUPAC name is 2-[6-bromo-5-fluoro-1-oxo-4-(phosphanylmethyl)phthalazin-2-yl]-N-(5-fluoropyrimidin-2-yl)acetamide.
| Compound Name | 2-[6-bromo-5-fluoro-1-oxo-4-(phosphanylmethyl)phthalazin-2-yl]-N-(5-fluoropyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 170369679 |
| Molecular Formula | C15H11BrF2N5O2P |
| Molecular Weight | 442.16 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 2-[6-bromo-5-fluoro-1-oxo-4-(phosphanylmethyl)phthalazin-2-yl]-N-(5-fluoropyrimidin-2-yl)acetamide |
| SMILES | O=C(Cn1nc(CP)c2c(F)c(Br)ccc2c1=O)Nc1ncc(F)cn1 |
| InChI | InChI=1S/C15H11BrF2N5O2P/c16-9-2-1-8-12(13(9)18)10(6-26)22-23(14(8)25)5-11(24)21-15-19-3-7(17)4-20-15/h1-4H,5-6,26H2,(H,19,20,21,24) |
| InChIKey | BJJFDZLEHIQIPY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.16 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|