About 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline
7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline (PubChem CID 170370283) has the molecular formula C15H13BrClN5
and a molecular weight of 378.66 g/mol. Its IUPAC name is 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline.
Molecular Properties
| Compound Name | 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline |
| PubChem CID | 170370283 |
| Molecular Formula | C15H13BrClN5 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline |
| SMILES | Clc1cc2c(-n3cncn3)cc(N3CCCC3)nc2cc1Br |
| InChI | InChI=1S/C15H13BrClN5/c16-11-6-13-10(5-12(11)17)14(22-9-18-8-19-22)7-15(20-13)21-3-1-2-4-21/h5-9H,1-4H2 |
| InChIKey | HEUGERMRJCJUNP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline?
The IUPAC name of 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline (CID 170370283) is 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline.
What is the SMILES notation for 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline?
The canonical SMILES for 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline is Clc1cc2c(-n3cncn3)cc(N3CCCC3)nc2cc1Br.
What is the InChIKey of 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline?
The InChIKey is HEUGERMRJCJUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrClN5/c16-11-6-13-10(5-12(11)17)14(22-9-18-8-19-22)7-15(20-13)21-3-1-2-4-21/h5-9H,1-4H2.
What are the key properties of 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline?
7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline has a molecular weight of 378.66 g/mol, XLogP of 3.83, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-6-chloro-2-pyrrolidin-1-yl-4-(1,2,4-triazol-1-yl)quinoline is sourced from PubChem (CID 170370283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).