C12H14N2 — CID 170370449
2,3,5,6-tetrahydrocarbazol-9-amine (PubChem CID 170370449) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,3,5,6-tetrahydrocarbazol-9-amine.
| Compound Name | 2,3,5,6-tetrahydrocarbazol-9-amine |
|---|---|
| PubChem CID | 170370449 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,3,5,6-tetrahydrocarbazol-9-amine |
| SMILES | Nn1c2c(c3c1=CCCC=3)CCC=C2 |
| InChI | InChI=1S/C12H14N2/c13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h3,6-8H,1-2,4-5,13H2 |
| InChIKey | STHFNIKBOLLDLX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |