C45H28N4O11 — CID 170370909
6-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-[9-(3-phenylcarbazol-9-yl)dibenzofuran-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 170370909) has the molecular formula C45H28N4O11 and a molecular weight of 800.74 g/mol. Its IUPAC name is 6-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-[9-(3-phenylcarbazol-9-yl)dibenzofuran-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-[9-(3-phenylcarbazol-9-yl)dibenzofuran-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 170370909 |
| Molecular Formula | C45H28N4O11 |
| Molecular Weight | 800.74 g/mol |
| Exact Mass | 800.18 |
| IUPAC Name | 6-[4-(2,3,4,5,6-pentahydroxyphenyl)-6-[9-(3-phenylcarbazol-9-yl)dibenzofuran-2-yl]-1,3,5-triazin-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2nc(-c3ccc4oc5cccc(-n6c7ccccc7c7cc(-c8ccccc8)ccc76)c5c4c3)nc(-c3c(O)c(O)c(O)c(O)c3O)n2)c(O)c1O |
| InChI | InChI=1S/C45H28N4O11/c50-33-31(34(51)38(55)41(58)37(33)54)44-46-43(47-45(48-44)32-35(52)39(56)42(59)40(57)36(32)53)21-14-16-28-24(18-21)30-27(11-6-12-29(30)60-28)49-25-10-5-4-9-22(25)23-17-20(13-15-26(23)49)19-7-2-1-3-8-19/h1-18,50-59H |
| InChIKey | ZWYZPOBYYUJPFS-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 259.04 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.74 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|