C29H28Cl2F3NO8S — CID 170371282
2-[4-[3-[3-[4-(2-carboxyethyl)-2,6-dichlorophenoxy]propylsulfonyl]propoxy]-3-(trifluoromethyl)anilino]benzoic acid (PubChem CID 170371282) has the molecular formula C29H28Cl2F3NO8S and a molecular weight of 678.51 g/mol. Its IUPAC name is 2-[4-[3-[3-[4-(2-carboxyethyl)-2,6-dichlorophenoxy]propylsulfonyl]propoxy]-3-(trifluoromethyl)anilino]benzoic acid.
| Compound Name | 2-[4-[3-[3-[4-(2-carboxyethyl)-2,6-dichlorophenoxy]propylsulfonyl]propoxy]-3-(trifluoromethyl)anilino]benzoic acid |
|---|---|
| PubChem CID | 170371282 |
| Molecular Formula | C29H28Cl2F3NO8S |
| Molecular Weight | 678.51 g/mol |
| Exact Mass | 677.09 |
| IUPAC Name | 2-[4-[3-[3-[4-(2-carboxyethyl)-2,6-dichlorophenoxy]propylsulfonyl]propoxy]-3-(trifluoromethyl)anilino]benzoic acid |
| SMILES | O=C(O)CCc1cc(Cl)c(OCCCS(=O)(=O)CCCOc2ccc(Nc3ccccc3C(=O)O)cc2C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C29H28Cl2F3NO8S/c30-22-15-18(7-10-26(36)37)16-23(31)27(22)43-12-4-14-44(40,41)13-3-11-42-25-9-8-19(17-21(25)29(32,33)34)35-24-6-2-1-5-20(24)28(38)39/h1-2,5-6,8-9,15-17,35H,3-4,7,10-14H2,(H,36,37)(H,38,39) |
| InChIKey | YZIICEAWZKKOPP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|