About (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane
(5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane (PubChem CID 170371460) has the molecular formula C11H22N2OS2
and a molecular weight of 262.44 g/mol. Its IUPAC name is (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane.
Molecular Properties
| Compound Name | (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane |
| PubChem CID | 170371460 |
| Molecular Formula | C11H22N2OS2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane |
| SMILES | CSCCS(C)(C)c1nnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C11H22N2OS2/c1-11(2,3)9-12-13-10(14-9)16(5,6)8-7-15-4/h7-8H2,1-6H3 |
| InChIKey | GDDUXRWVDGVEHQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane?
The IUPAC name of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane (CID 170371460) is (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane.
What is the SMILES notation for (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane?
The canonical SMILES for (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane is CSCCS(C)(C)c1nnc(C(C)(C)C)o1.
What is the InChIKey of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane?
The InChIKey is GDDUXRWVDGVEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2OS2/c1-11(2,3)9-12-13-10(14-9)16(5,6)8-7-15-4/h7-8H2,1-6H3.
What are the key properties of (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane?
(5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane has a molecular weight of 262.44 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-1,3,4-oxadiazol-2-yl)-dimethyl-(2-methylsulfanylethyl)-λ4-sulfane is sourced from PubChem (CID 170371460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).