C20H38N2 — CID 170371526
1-propan-2-yl-4-(2,4,4,5-tetramethyl-3-methylideneoct-6-en-2-yl)piperazine (PubChem CID 170371526) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 1-propan-2-yl-4-(2,4,4,5-tetramethyl-3-methylideneoct-6-en-2-yl)piperazine.
| Compound Name | 1-propan-2-yl-4-(2,4,4,5-tetramethyl-3-methylideneoct-6-en-2-yl)piperazine |
|---|---|
| PubChem CID | 170371526 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | 1-propan-2-yl-4-(2,4,4,5-tetramethyl-3-methylideneoct-6-en-2-yl)piperazine |
| SMILES | C=C(C(C)(C)C(C)C=CC)C(C)(C)N1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C20H38N2/c1-10-11-17(4)19(6,7)18(5)20(8,9)22-14-12-21(13-15-22)16(2)3/h10-11,16-17H,5,12-15H2,1-4,6-9H3 |
| InChIKey | XTSDAKSLKOFAQV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|