About 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one
2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one (PubChem CID 170372418) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one.
Molecular Properties
| Compound Name | 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one |
| PubChem CID | 170372418 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one |
| SMILES | C=C1COC(c2ncc3ccccn23)C(=O)N1 |
| InChI | InChI=1S/C12H11N3O2/c1-8-7-17-10(12(16)14-8)11-13-6-9-4-2-3-5-15(9)11/h2-6,10H,1,7H2,(H,14,16) |
| InChIKey | DFSHSGWDFPGLGL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one?
The IUPAC name of 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one (CID 170372418) is 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one.
What is the SMILES notation for 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one?
The canonical SMILES for 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one is C=C1COC(c2ncc3ccccn23)C(=O)N1.
What is the InChIKey of 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one?
The InChIKey is DFSHSGWDFPGLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c1-8-7-17-10(12(16)14-8)11-13-6-9-4-2-3-5-15(9)11/h2-6,10H,1,7H2,(H,14,16).
What are the key properties of 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one?
2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one has a molecular weight of 229.24 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,5-a]pyridin-3-yl-5-methylidenemorpholin-3-one is sourced from PubChem (CID 170372418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).