About N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide
N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide (PubChem CID 170372596) has the molecular formula C10H11N3O4S
and a molecular weight of 269.28 g/mol. Its IUPAC name is N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide |
| PubChem CID | 170372596 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide |
| SMILES | C=C1NC(=O)C2(NS(=O)(=O)c3cocn3)CC1C2 |
| InChI | InChI=1S/C10H11N3O4S/c1-6-7-2-10(3-7,9(14)12-6)13-18(15,16)8-4-17-5-11-8/h4-5,7,13H,1-3H2,(H,12,14) |
| InChIKey | QOHCKHKICLCTAQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide?
The IUPAC name of N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide (CID 170372596) is N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide.
What is the SMILES notation for N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide?
The canonical SMILES for N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide is C=C1NC(=O)C2(NS(=O)(=O)c3cocn3)CC1C2.
What is the InChIKey of N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide?
The InChIKey is QOHCKHKICLCTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O4S/c1-6-7-2-10(3-7,9(14)12-6)13-18(15,16)8-4-17-5-11-8/h4-5,7,13H,1-3H2,(H,12,14).
What are the key properties of N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide?
N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide has a molecular weight of 269.28 g/mol, XLogP of -0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylidene-2-oxo-3-azabicyclo[3.1.1]heptan-1-yl)-1,3-oxazole-4-sulfonamide is sourced from PubChem (CID 170372596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).