C23H23N3O3 — CID 17037322
1-phenylspiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 17037322) has the molecular formula C23H23N3O3 and a molecular weight of 389.45 g/mol. Its IUPAC name is 1-phenylspiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 1-phenylspiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 17037322 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-phenylspiro[1,3-diazinane-5,6'-6a,7,8,9,10,11-hexahydro-5H-azepino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | O=C1NC(=O)C2(Cc3ccccc3N3CCCCCC32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C23H23N3O3/c27-20-23(21(28)26(22(29)24-20)17-10-3-1-4-11-17)15-16-9-6-7-12-18(16)25-14-8-2-5-13-19(23)25/h1,3-4,6-7,9-12,19H,2,5,8,13-15H2,(H,24,27,29) |
| InChIKey | OYGSHAXVUFVUJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|