C44H34N2 — CID 170373330
2,7-bis[4-(4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)cyclopenta-1,3-dien-1-yl]-3,8-dihydroindolo[6,5-f]indole (PubChem CID 170373330) has the molecular formula C44H34N2 and a molecular weight of 590.77 g/mol. Its IUPAC name is 2,7-bis[4-(4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)cyclopenta-1,3-dien-1-yl]-3,8-dihydroindolo[6,5-f]indole.
| Compound Name | 2,7-bis[4-(4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)cyclopenta-1,3-dien-1-yl]-3,8-dihydroindolo[6,5-f]indole |
|---|---|
| PubChem CID | 170373330 |
| Molecular Formula | C44H34N2 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 2,7-bis[4-(4-cyclopenta-1,3-dien-1-ylcyclopenta-1,3-dien-1-yl)cyclopenta-1,3-dien-1-yl]-3,8-dihydroindolo[6,5-f]indole |
| SMILES | C1=CCC(C2=CC=C(C3=CC=C(C4=Nc5cc6cc7c(cc6cc5C4)N=C(C4=CC=C(C5=CC=C(C6=CC=CC6)C5)C4)C7)C3)C2)=C1 |
| InChI | InChI=1S/C44H34N2/c1-2-6-27(5-1)29-9-11-31(17-29)33-13-15-35(19-33)41-25-39-21-37-24-44-40(22-38(37)23-43(39)45-41)26-42(46-44)36-16-14-34(20-36)32-12-10-30(18-32)28-7-3-4-8-28/h1-5,7,9-16,21-24H,6,8,17-20,25-26H2 |
| InChIKey | RMIKDCSTTFUXNB-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |