About N-propan-2-ylhepta-2,4-diyn-1-amine
N-propan-2-ylhepta-2,4-diyn-1-amine (PubChem CID 170374005) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N-propan-2-ylhepta-2,4-diyn-1-amine.
Molecular Properties
| Compound Name | N-propan-2-ylhepta-2,4-diyn-1-amine |
| PubChem CID | 170374005 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-propan-2-ylhepta-2,4-diyn-1-amine |
| SMILES | CCC#CC#CCNC(C)C |
| InChI | InChI=1S/C10H15N/c1-4-5-6-7-8-9-11-10(2)3/h10-11H,4,9H2,1-3H3 |
| InChIKey | XQQGCPXSBQAFJE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-ylhepta-2,4-diyn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-ylhepta-2,4-diyn-1-amine?
The IUPAC name of N-propan-2-ylhepta-2,4-diyn-1-amine (CID 170374005) is N-propan-2-ylhepta-2,4-diyn-1-amine.
What is the SMILES notation for N-propan-2-ylhepta-2,4-diyn-1-amine?
The canonical SMILES for N-propan-2-ylhepta-2,4-diyn-1-amine is CCC#CC#CCNC(C)C.
What is the InChIKey of N-propan-2-ylhepta-2,4-diyn-1-amine?
The InChIKey is XQQGCPXSBQAFJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-4-5-6-7-8-9-11-10(2)3/h10-11H,4,9H2,1-3H3.
What are the key properties of N-propan-2-ylhepta-2,4-diyn-1-amine?
N-propan-2-ylhepta-2,4-diyn-1-amine has a molecular weight of 149.24 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-ylhepta-2,4-diyn-1-amine is sourced from PubChem (CID 170374005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).