C17H18S — CID 170374433
2,3,4,7,8-pentamethyldibenzothiophene (PubChem CID 170374433) has the molecular formula C17H18S and a molecular weight of 254.40 g/mol. Its IUPAC name is 2,3,4,7,8-pentamethyldibenzothiophene.
| Compound Name | 2,3,4,7,8-pentamethyldibenzothiophene |
|---|---|
| PubChem CID | 170374433 |
| Molecular Formula | C17H18S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2,3,4,7,8-pentamethyldibenzothiophene |
| SMILES | Cc1cc2sc3c(C)c(C)c(C)cc3c2cc1C |
| InChI | InChI=1S/C17H18S/c1-9-6-14-15-7-11(3)12(4)13(5)17(15)18-16(14)8-10(9)2/h6-8H,1-5H3 |
| InChIKey | JLSFBBFFRDNXJS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |