C19H23ClFN5S — CID 170374929
(4R,7S,8S,9S)-13-chloro-9-ethyl-17-ethylsulfanyl-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene (PubChem CID 170374929) has the molecular formula C19H23ClFN5S and a molecular weight of 407.95 g/mol. Its IUPAC name is (4R,7S,8S,9S)-13-chloro-9-ethyl-17-ethylsulfanyl-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene.
| Compound Name | (4R,7S,8S,9S)-13-chloro-9-ethyl-17-ethylsulfanyl-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene |
|---|---|
| PubChem CID | 170374929 |
| Molecular Formula | C19H23ClFN5S |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (4R,7S,8S,9S)-13-chloro-9-ethyl-17-ethylsulfanyl-14-fluoro-2,12,16,18,20-pentazapentacyclo[9.7.1.14,7.02,8.015,19]icosa-1(18),11(19),12,14,16-pentaene |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)C[C@H](CC)[C@H]1[C@@H]3CC[C@H](CN21)N3 |
| InChI | InChI=1S/C19H23ClFN5S/c1-3-9-7-12-13-15(14(21)17(20)23-12)24-19(27-4-2)25-18(13)26-8-10-5-6-11(22-10)16(9)26/h9-11,16,22H,3-8H2,1-2H3/t9-,10+,11-,16-/m0/s1 |
| InChIKey | MGDOFOACTLKAPQ-BBKSZCTCSA-N |
| XLogP | 3.82 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|