About 3-decan-5-ylpyridine
3-decan-5-ylpyridine (PubChem CID 170375029) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-decan-5-ylpyridine.
Molecular Properties
| Compound Name | 3-decan-5-ylpyridine |
| PubChem CID | 170375029 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-decan-5-ylpyridine |
| SMILES | CCCCCC(CCCC)c1cccnc1 |
| InChI | InChI=1S/C15H25N/c1-3-5-7-10-14(9-6-4-2)15-11-8-12-16-13-15/h8,11-14H,3-7,9-10H2,1-2H3 |
| InChIKey | GRYPMHCZGXVXQD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-decan-5-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-decan-5-ylpyridine?
The IUPAC name of 3-decan-5-ylpyridine (CID 170375029) is 3-decan-5-ylpyridine.
What is the SMILES notation for 3-decan-5-ylpyridine?
The canonical SMILES for 3-decan-5-ylpyridine is CCCCCC(CCCC)c1cccnc1.
What is the InChIKey of 3-decan-5-ylpyridine?
The InChIKey is GRYPMHCZGXVXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-3-5-7-10-14(9-6-4-2)15-11-8-12-16-13-15/h8,11-14H,3-7,9-10H2,1-2H3.
What are the key properties of 3-decan-5-ylpyridine?
3-decan-5-ylpyridine has a molecular weight of 219.37 g/mol, XLogP of 4.94, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-decan-5-ylpyridine is sourced from PubChem (CID 170375029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).