About 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine
6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 170375121) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine |
| PubChem CID | 170375121 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | CC(C)C1=CC2N=CSC2C=N1 |
| InChI | InChI=1S/C9H12N2S/c1-6(2)7-3-8-9(4-10-7)12-5-11-8/h3-6,8-9H,1-2H3 |
| InChIKey | BBCRXGJWIMCYPH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine?
The IUPAC name of 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine (CID 170375121) is 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine.
What is the SMILES notation for 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine?
The canonical SMILES for 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine is CC(C)C1=CC2N=CSC2C=N1.
What is the InChIKey of 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine?
The InChIKey is BBCRXGJWIMCYPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-6(2)7-3-8-9(4-10-7)12-5-11-8/h3-6,8-9H,1-2H3.
What are the key properties of 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine?
6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine has a molecular weight of 180.28 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-3a,7a-dihydro-[1,3]thiazolo[5,4-c]pyridine is sourced from PubChem (CID 170375121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).