About (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide
(3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide (PubChem CID 170376335) has the molecular formula C11H13FN2O3
and a molecular weight of 240.23 g/mol. Its IUPAC name is (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide.
Molecular Properties
| Compound Name | (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide |
| PubChem CID | 170376335 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide |
| SMILES | CC1=C(C(=O)NC2CCC(=O)NC2=O)C[C@@H]1F |
| InChI | InChI=1S/C11H13FN2O3/c1-5-6(4-7(5)12)10(16)13-8-2-3-9(15)14-11(8)17/h7-8H,2-4H2,1H3,(H,13,16)(H,14,15,17)/t7-,8?/m0/s1 |
| InChIKey | WIQHJYKQDHSXMX-JAMMHHFISA-N |
| XLogP | -0.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide?
The IUPAC name of (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide (CID 170376335) is (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide.
What is the SMILES notation for (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide?
The canonical SMILES for (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide is CC1=C(C(=O)NC2CCC(=O)NC2=O)C[C@@H]1F.
What is the InChIKey of (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide?
The InChIKey is WIQHJYKQDHSXMX-JAMMHHFISA-N. The full InChI is InChI=1S/C11H13FN2O3/c1-5-6(4-7(5)12)10(16)13-8-2-3-9(15)14-11(8)17/h7-8H,2-4H2,1H3,(H,13,16)(H,14,15,17)/t7-,8?/m0/s1.
What are the key properties of (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide?
(3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide has a molecular weight of 240.23 g/mol, XLogP of -0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-(2,6-dioxopiperidin-3-yl)-3-fluoro-2-methylcyclobutene-1-carboxamide is sourced from PubChem (CID 170376335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).