About 2-chloroethyl 2-methylprop-2-enimidate
2-chloroethyl 2-methylprop-2-enimidate (PubChem CID 170376546) has the molecular formula C6H10ClNO
and a molecular weight of 147.60 g/mol. Its IUPAC name is 2-chloroethyl 2-methylprop-2-enimidate.
Molecular Properties
| Compound Name | 2-chloroethyl 2-methylprop-2-enimidate |
| PubChem CID | 170376546 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 2-chloroethyl 2-methylprop-2-enimidate |
| SMILES | [H]/N=C(\OCCCl)C(=C)C |
| InChI | InChI=1S/C6H10ClNO/c1-5(2)6(8)9-4-3-7/h8H,1,3-4H2,2H3/b8-6- |
| InChIKey | SCRSIJRUCDZTQG-VURMDHGXSA-N |
| XLogP | 1.80 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl 2-methylprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl 2-methylprop-2-enimidate?
The IUPAC name of 2-chloroethyl 2-methylprop-2-enimidate (CID 170376546) is 2-chloroethyl 2-methylprop-2-enimidate.
What is the SMILES notation for 2-chloroethyl 2-methylprop-2-enimidate?
The canonical SMILES for 2-chloroethyl 2-methylprop-2-enimidate is [H]/N=C(\OCCCl)C(=C)C.
What is the InChIKey of 2-chloroethyl 2-methylprop-2-enimidate?
The InChIKey is SCRSIJRUCDZTQG-VURMDHGXSA-N. The full InChI is InChI=1S/C6H10ClNO/c1-5(2)6(8)9-4-3-7/h8H,1,3-4H2,2H3/b8-6-.
What are the key properties of 2-chloroethyl 2-methylprop-2-enimidate?
2-chloroethyl 2-methylprop-2-enimidate has a molecular weight of 147.60 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl 2-methylprop-2-enimidate is sourced from PubChem (CID 170376546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).