About 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole
6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole (PubChem CID 170376837) has the molecular formula C9H16S2
and a molecular weight of 188.36 g/mol. Its IUPAC name is 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole.
Molecular Properties
| Compound Name | 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole |
| PubChem CID | 170376837 |
| Molecular Formula | C9H16S2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole |
| SMILES | CC(C)C12CCCC1CSS2 |
| InChI | InChI=1S/C9H16S2/c1-7(2)9-5-3-4-8(9)6-10-11-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | PLXVSQHFKHSGAE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole?
The IUPAC name of 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole (CID 170376837) is 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole.
What is the SMILES notation for 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole?
The canonical SMILES for 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole is CC(C)C12CCCC1CSS2.
What is the InChIKey of 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole?
The InChIKey is PLXVSQHFKHSGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16S2/c1-7(2)9-5-3-4-8(9)6-10-11-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole?
6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole has a molecular weight of 188.36 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6a-propan-2-yl-3a,4,5,6-tetrahydro-3H-cyclopenta[c]dithiole is sourced from PubChem (CID 170376837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).