C19H19Cl2NO3 — CID 170377307
ethyl (Z)-2-chloro-3-[2-chloro-5-(3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl)phenyl]prop-2-enoate (PubChem CID 170377307) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is ethyl (Z)-2-chloro-3-[2-chloro-5-(3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl)phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-chloro-3-[2-chloro-5-(3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 170377307 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | ethyl (Z)-2-chloro-3-[2-chloro-5-(3-oxo-4,5,6,7-tetrahydro-1H-isoindol-2-yl)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(Cl)=C/c1cc(N2CC3=C(CCCC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C19H19Cl2NO3/c1-2-25-19(24)17(21)10-13-9-14(7-8-16(13)20)22-11-12-5-3-4-6-15(12)18(22)23/h7-10H,2-6,11H2,1H3/b17-10- |
| InChIKey | HDZYNGRDRUKPDQ-YVLHZVERSA-N |
| XLogP | 4.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|