C51H31N3O2 — CID 170378467
2-phenyl-4-[6-(3-phenyldibenzofuran-1-yl)dibenzofuran-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 170378467) has the molecular formula C51H31N3O2 and a molecular weight of 717.83 g/mol. Its IUPAC name is 2-phenyl-4-[6-(3-phenyldibenzofuran-1-yl)dibenzofuran-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[6-(3-phenyldibenzofuran-1-yl)dibenzofuran-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170378467 |
| Molecular Formula | C51H31N3O2 |
| Molecular Weight | 717.83 g/mol |
| Exact Mass | 717.24 |
| IUPAC Name | 2-phenyl-4-[6-(3-phenyldibenzofuran-1-yl)dibenzofuran-3-yl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)oc4c(-c6cc(-c7ccccc7)cc7oc8ccccc8c67)cccc45)n3)cc2)cc1 |
| InChI | InChI=1S/C51H31N3O2/c1-4-13-32(14-5-1)34-23-25-36(26-24-34)50-52-49(35-17-8-3-9-18-35)53-51(54-50)37-27-28-39-40-20-12-21-41(48(40)56-45(39)30-37)43-29-38(33-15-6-2-7-16-33)31-46-47(43)42-19-10-11-22-44(42)55-46/h1-31H |
| InChIKey | RZRNYKHPCAEEOH-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.83 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |