C23H23F4N5O3 — CID 170378591
(4aR,8aS)-6-[6-[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrazol-3-yl]-3-azabicyclo[3.1.0]hexane-3-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 170378591) has the molecular formula C23H23F4N5O3 and a molecular weight of 493.46 g/mol. Its IUPAC name is (4aR,8aS)-6-[6-[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrazol-3-yl]-3-azabicyclo[3.1.0]hexane-3-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[6-[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrazol-3-yl]-3-azabicyclo[3.1.0]hexane-3-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 170378591 |
| Molecular Formula | C23H23F4N5O3 |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (4aR,8aS)-6-[6-[1-[4-fluoro-3-(trifluoromethyl)phenyl]pyrazol-3-yl]-3-azabicyclo[3.1.0]hexane-3-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC4C(C3)C4c3ccn(-c4ccc(F)c(C(F)(F)F)c4)n3)C[C@H]2N1 |
| InChI | InChI=1S/C23H23F4N5O3/c24-16-2-1-12(7-15(16)23(25,26)27)32-6-3-17(29-32)21-13-8-31(9-14(13)21)22(34)30-5-4-19-18(10-30)28-20(33)11-35-19/h1-3,6-7,13-14,18-19,21H,4-5,8-11H2,(H,28,33)/t13?,14?,18-,19+,21?/m1/s1 |
| InChIKey | VGOAIZLSUYVONN-LRPRHABSSA-N |
| XLogP | 2.38 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |