C50H40N2 — CID 170378651
N-[4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-phenylindol-5-yl]phenyl]-9,9-dimethyl-N-naphthalen-1-ylfluoren-2-amine (PubChem CID 170378651) has the molecular formula C50H40N2 and a molecular weight of 668.88 g/mol. Its IUPAC name is N-[4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-phenylindol-5-yl]phenyl]-9,9-dimethyl-N-naphthalen-1-ylfluoren-2-amine.
| Compound Name | N-[4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-phenylindol-5-yl]phenyl]-9,9-dimethyl-N-naphthalen-1-ylfluoren-2-amine |
|---|---|
| PubChem CID | 170378651 |
| Molecular Formula | C50H40N2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | N-[4-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-1-phenylindol-5-yl]phenyl]-9,9-dimethyl-N-naphthalen-1-ylfluoren-2-amine |
| SMILES | C=C/C=C\c1c(C)c2cc(-c3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4cccc5ccccc45)cc3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C50H40N2/c1-5-6-22-47-34(2)44-32-37(26-31-49(44)52(47)38-17-8-7-9-18-38)35-24-27-39(28-25-35)51(48-23-14-16-36-15-10-11-19-41(36)48)40-29-30-43-42-20-12-13-21-45(42)50(3,4)46(43)33-40/h5-33H,1H2,2-4H3/b22-6- |
| InChIKey | NDXXIRVGWIPHSD-HCDFXORVSA-N |
| XLogP | 13.73 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|