C51H29N3O2S — CID 170378841
2-dibenzofuran-3-yl-4-phenyl-6-[9-(1-phenyldibenzothiophen-3-yl)dibenzofuran-4-yl]-1,3,5-triazine (PubChem CID 170378841) has the molecular formula C51H29N3O2S and a molecular weight of 747.88 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-phenyl-6-[9-(1-phenyldibenzothiophen-3-yl)dibenzofuran-4-yl]-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-phenyl-6-[9-(1-phenyldibenzothiophen-3-yl)dibenzofuran-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 170378841 |
| Molecular Formula | C51H29N3O2S |
| Molecular Weight | 747.88 g/mol |
| Exact Mass | 747.20 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-phenyl-6-[9-(1-phenyldibenzothiophen-3-yl)dibenzofuran-4-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3cccc4c3oc3cccc(-c5cc(-c6ccccc6)c6c(c5)sc5ccccc56)c34)n2)cc1 |
| InChI | InChI=1S/C51H29N3O2S/c1-3-13-30(14-4-1)40-27-33(29-45-47(40)37-18-8-10-24-44(37)57-45)34-19-12-23-42-46(34)38-20-11-21-39(48(38)56-42)51-53-49(31-15-5-2-6-16-31)52-50(54-51)32-25-26-36-35-17-7-9-22-41(35)55-43(36)28-32/h1-29H |
| InChIKey | RRLVGLUVGFUUIE-UHFFFAOYSA-N |
| XLogP | 14.37 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.88 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |