C31H40N4O5 — CID 170379563
(4R)-4-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-N-[6-ethynyl-3-hydroxy-2,2,3-trimethyl-5-[(Z)-prop-1-enyl]-4H-pyran-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide (PubChem CID 170379563) has the molecular formula C31H40N4O5 and a molecular weight of 548.68 g/mol. Its IUPAC name is (4R)-4-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-N-[6-ethynyl-3-hydroxy-2,2,3-trimethyl-5-[(Z)-prop-1-enyl]-4H-pyran-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide.
| Compound Name | (4R)-4-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-N-[6-ethynyl-3-hydroxy-2,2,3-trimethyl-5-[(Z)-prop-1-enyl]-4H-pyran-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 170379563 |
| Molecular Formula | C31H40N4O5 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (4R)-4-(2-amino-4,4-diethyl-6-oxo-5H-pyrimidin-1-yl)-N-[6-ethynyl-3-hydroxy-2,2,3-trimethyl-5-[(Z)-prop-1-enyl]-4H-pyran-4-yl]-3,4-dihydro-2H-chromene-6-carboxamide |
| SMILES | C#CC1=C(/C=C\C)C(NC(=O)c2ccc3c(c2)[C@H](N2C(=O)CC(CC)(CC)N=C2N)CCO3)C(C)(O)C(C)(C)O1 |
| InChI | InChI=1S/C31H40N4O5/c1-8-12-20-23(9-2)40-29(5,6)30(7,38)26(20)33-27(37)19-13-14-24-21(17-19)22(15-16-39-24)35-25(36)18-31(10-3,11-4)34-28(35)32/h2,8,12-14,17,22,26,38H,10-11,15-16,18H2,1,3-7H3,(H2,32,34)(H,33,37)/b12-8-/t22-,26?,30?/m1/s1 |
| InChIKey | YSINDFNUYIIWHO-WMVMBWLASA-N |
| XLogP | 3.74 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|