C12H21N2+ — CID 170379880
4,8,8-trimethyl-10-methylidene-5,6,7,9-tetrahydro-1,4-diazecin-4-ium (PubChem CID 170379880) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is 4,8,8-trimethyl-10-methylidene-5,6,7,9-tetrahydro-1,4-diazecin-4-ium.
| Compound Name | 4,8,8-trimethyl-10-methylidene-5,6,7,9-tetrahydro-1,4-diazecin-4-ium |
|---|---|
| PubChem CID | 170379880 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | 4,8,8-trimethyl-10-methylidene-5,6,7,9-tetrahydro-1,4-diazecin-4-ium |
| SMILES | C=C1CC(C)(C)CCC/[N+](C)=C/C=N\1 |
| InChI | InChI=1S/C12H21N2/c1-11-10-12(2,3)6-5-8-14(4)9-7-13-11/h7,9H,1,5-6,8,10H2,2-4H3/q+1/b13-7-,14-9+ |
| InChIKey | HVADRVBCHKKRJR-MHIRLISYSA-N |
| XLogP | 2.49 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|