C17H27N — CID 170381400
(2Z,5Z)-N,3,5-trimethyl-4-propan-2-yl-2-prop-1-en-2-ylocta-2,5,7-trien-1-imine (PubChem CID 170381400) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is (2Z,5Z)-N,3,5-trimethyl-4-propan-2-yl-2-prop-1-en-2-ylocta-2,5,7-trien-1-imine.
| Compound Name | (2Z,5Z)-N,3,5-trimethyl-4-propan-2-yl-2-prop-1-en-2-ylocta-2,5,7-trien-1-imine |
|---|---|
| PubChem CID | 170381400 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (2Z,5Z)-N,3,5-trimethyl-4-propan-2-yl-2-prop-1-en-2-ylocta-2,5,7-trien-1-imine |
| SMILES | C=C/C=C(/C)C(/C(C)=C(\C=N\C)C(=C)C)C(C)C |
| InChI | InChI=1S/C17H27N/c1-9-10-14(6)17(13(4)5)15(7)16(11-18-8)12(2)3/h9-11,13,17H,1-2H2,3-8H3/b14-10-,16-15+,18-11+ |
| InChIKey | HSSZODSXHHFKGV-QUISJIHJSA-N |
| XLogP | 4.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|