About 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole
3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole (PubChem CID 170381814) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole |
| PubChem CID | 170381814 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole |
| SMILES | CCc1cc(CCC(C)c2cnc(C)s2)on1 |
| InChI | InChI=1S/C13H18N2OS/c1-4-11-7-12(16-15-11)6-5-9(2)13-8-14-10(3)17-13/h7-9H,4-6H2,1-3H3 |
| InChIKey | MITGOHBAZDZITM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole?
The IUPAC name of 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole (CID 170381814) is 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole.
What is the SMILES notation for 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole?
The canonical SMILES for 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole is CCc1cc(CCC(C)c2cnc(C)s2)on1.
What is the InChIKey of 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole?
The InChIKey is MITGOHBAZDZITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-4-11-7-12(16-15-11)6-5-9(2)13-8-14-10(3)17-13/h7-9H,4-6H2,1-3H3.
What are the key properties of 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole?
3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole has a molecular weight of 250.37 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-[3-(2-methyl-1,3-thiazol-5-yl)butyl]-1,2-oxazole is sourced from PubChem (CID 170381814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).