About (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one
(3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one (PubChem CID 170382339) has the molecular formula C6H9F2NO2
and a molecular weight of 165.14 g/mol. Its IUPAC name is (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one |
| PubChem CID | 170382339 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one |
| SMILES | CN1CC(F)(F)[C@](C)(O)C1=O |
| InChI | InChI=1S/C6H9F2NO2/c1-5(11)4(10)9(2)3-6(5,7)8/h11H,3H2,1-2H3/t5-/m1/s1 |
| InChIKey | JUUVHONNLHMGLW-RXMQYKEDSA-N |
| XLogP | -0.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one?
The IUPAC name of (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one (CID 170382339) is (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one.
What is the SMILES notation for (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one?
The canonical SMILES for (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one is CN1CC(F)(F)[C@](C)(O)C1=O.
What is the InChIKey of (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one?
The InChIKey is JUUVHONNLHMGLW-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H9F2NO2/c1-5(11)4(10)9(2)3-6(5,7)8/h11H,3H2,1-2H3/t5-/m1/s1.
What are the key properties of (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one?
(3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one has a molecular weight of 165.14 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4-difluoro-3-hydroxy-1,3-dimethylpyrrolidin-2-one is sourced from PubChem (CID 170382339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).