C15H21NO — CID 170382647
4-cyclopropyl-5-methyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-1,3-oxazole (PubChem CID 170382647) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-cyclopropyl-5-methyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-1,3-oxazole.
| Compound Name | 4-cyclopropyl-5-methyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 170382647 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 4-cyclopropyl-5-methyl-2-[(2E,4Z)-6-methylhepta-2,4-dien-2-yl]-1,3-oxazole |
| SMILES | C/C(=C\C=C/C(C)C)c1nc(C2CC2)c(C)o1 |
| InChI | InChI=1S/C15H21NO/c1-10(2)6-5-7-11(3)15-16-14(12(4)17-15)13-8-9-13/h5-7,10,13H,8-9H2,1-4H3/b6-5-,11-7+ |
| InChIKey | RTGRSSIKSVKBPT-GNLLZQBYSA-N |
| XLogP | 4.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|