About 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane
2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane (PubChem CID 170383348) has the molecular formula C34H68O3S4
and a molecular weight of 653.18 g/mol. Its IUPAC name is 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane |
| PubChem CID | 170383348 |
| Molecular Formula | C34H68O3S4 |
| Molecular Weight | 653.18 g/mol |
| Exact Mass | 652.41 |
| IUPAC Name | 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane |
| SMILES | CCCCSCCSCCCCCCCCC1(CCCCCCCCSCCSCCCC)OCC(CCOC)O1 |
| InChI | InChI=1S/C34H68O3S4/c1-4-6-24-38-28-30-40-26-18-14-10-8-12-16-21-34(36-32-33(37-34)20-23-35-3)22-17-13-9-11-15-19-27-41-31-29-39-25-7-5-2/h33H,4-32H2,1-3H3 |
| InChIKey | XEZLAQASARRQQP-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 653.18 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane?
The IUPAC name of 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane (CID 170383348) is 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane.
What is the SMILES notation for 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane?
The canonical SMILES for 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane is CCCCSCCSCCCCCCCCC1(CCCCCCCCSCCSCCCC)OCC(CCOC)O1.
What is the InChIKey of 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane?
The InChIKey is XEZLAQASARRQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H68O3S4/c1-4-6-24-38-28-30-40-26-18-14-10-8-12-16-21-34(36-32-33(37-34)20-23-35-3)22-17-13-9-11-15-19-27-41-31-29-39-25-7-5-2/h33H,4-32H2,1-3H3.
What are the key properties of 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane?
2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane has a molecular weight of 653.18 g/mol, XLogP of 11.13, 33 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis[8-(2-butylsulfanylethylsulfanyl)octyl]-4-(2-methoxyethyl)-1,3-dioxolane is sourced from PubChem (CID 170383348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).